Crystal structure of bis(acetylacetonato)-bis(3-methylpyridine)-nickel(II) dihydrate, Ni(C6H7N)(2)(C5H7O2)(2)center dot 2H(2)O

Nenhuma Miniatura disponível

Data

2007-01-01

Orientador

Coorientador

Pós-graduação

Curso de graduação

Título da Revista

ISSN da Revista

Título de Volume

Editor

Oldenbourg Verlag

Tipo

Artigo

Direito de acesso

Acesso abertoAcesso Aberto

Resumo

C22H32N2NiO6, triclinic, P (1) over bar (no. 2), a = 8.335(1) angstrom, b = 9.314(1) angstrom, c = 17.045(2) angstrom, alpha = 88.45(1)degrees, beta = 82.12(1)degrees, gamma = 70.296(9)degrees, V = 1233.7 angstrom(3), Z = 2, R-gt(F) = 0.050, wR(ref)(F-2) = 0.177, T = 293 K.

Descrição

Palavras-chave

Idioma

Inglês

Como citar

Zeitschrift Fur Kristallographie-new Crystal Structures. Munich: Oldenbourg Verlag, v. 222, n. 1, p. 47-49, 2007.

Itens relacionados

Financiadores