Natale, A. A. [UNESP]2014-05-272014-05-271991-12-01Physics Letters, Section B: Nuclear, Elementary Particle and High-Energy Physics, v. 258, n. 1-2, p. 227-230, 1991.0370-2693http://hdl.handle.net/11449/132413We consider the possible neutrino emission from SN1987A generated through the process γγ→π0→νν, which is permitted when the neutrinos have a right-handed component. This energy-loss mechanism is consistent with the supernova neutrino observations if the decay rate I (π0→νν̄) < (0.15-6.3) × 10-13 eV. When the reaction π0→νν̄ is mediated by weak gauge bosons the limit on the decay rate allows us to obtain constraints on neutrino masses, mv<5-27 keV, depending on the core temperature.227-230engArtigo10.1016/0370-2693(91)91237-PWOS:A1991FH14600040Acesso restrito2-s2.0-0345637921