Preparation and Voltammetric Application of a Zr(IV) Functionalized Spongolite for the Electrocatalytic Oxidation of Hydrazine
| dc.contributor.author | Carmo, Devaney Ribeiro do [UNESP] | |
| dc.contributor.author | Souza, Tamires Rocha [UNESP] | |
| dc.contributor.author | Maraldi, Vitor Alexandre [UNESP] | |
| dc.contributor.author | Serantoni da Silveira, Tayla Fernanda [UNESP] | |
| dc.contributor.institution | Universidade Estadual Paulista (Unesp) | |
| dc.contributor.institution | Universidade Federal de Mato Grosso do Sul (UFMS) | |
| dc.date.accessioned | 2019-10-04T12:31:22Z | |
| dc.date.available | 2019-10-04T12:31:22Z | |
| dc.date.issued | 2018-11-01 | |
| dc.description.abstract | This study demonstrates an additional exploration of the possibilities of modifying the surface of spongolite spicules, a biogenic silica, in order to prepare natural inorganic composites for application in catalytic oxidation processes. In this context, a novel hybrid material was synthesized from the inorganofunctionalization of a spongolite with zirconium(IV) (EZr). This material was then reacted with potassium hexacyanoferrate(III) and applied in a subsequent reaction with copper ions. The obtained material (EZrCuH) was characterized by scanning electron microscopy (SEM), infrared spectroscopy (FT-IR), and cyclic voltammetry (CV). The CV of the graphite paste modified with EZrCuH exhibited two redox couples with midpoint potentials (E-theta,E-) equal to 0.36 and 0.74 V, attributed to the Cu-I/Cu-II and Fe-II(CN)(6)/Fe-III(CN)(6) processes (1.0 mol L-1, KCl pH 7.0, v = 20 mV s(-1)), respectively. The EZrCuH-modified graphite paste electrode presented electrocatalytic activity in the oxidation of different hydrazine concentrations and an analytical curve with a linear response of 8.0 x 10(-7) to 4.0 x 10(-5) mol L-1 (R-2 = 0.999, relative standard deviation = +/- 2% (n = 3)), and limit of detection of 8.33 x 10(-7) mol L-1 and an amperometric sensitivity of 8.21 mA mol(-1) L-1. Therefore, this material can be considered as a potential candidate for the manufacturing of electrochemical sensors intended for the easy and rapid detection of hydrazine substances. | en |
| dc.description.affiliation | Univ Estadual Paulista, Fac Engn Ilha Solteira, Dept Quim & Fis, Ave Brasil 56, BR-15385000 Ilha Solteira, SP, Brazil | |
| dc.description.affiliation | Univ Fed Mato Grosso do Sul, Inst Quim, Ave Senador Filinto Muller 1555, BR-79074460 Campo Grande, MS, Brazil | |
| dc.description.affiliationUnesp | Univ Estadual Paulista, Fac Engn Ilha Solteira, Dept Quim & Fis, Ave Brasil 56, BR-15385000 Ilha Solteira, SP, Brazil | |
| dc.format.extent | 706-715 | |
| dc.identifier | http://dx.doi.org/10.1007/s12678-018-0480-4 | |
| dc.identifier.citation | Electrocatalysis. New York: Springer, v. 9, n. 6, p. 706-715, 2018. | |
| dc.identifier.doi | 10.1007/s12678-018-0480-4 | |
| dc.identifier.issn | 1868-2529 | |
| dc.identifier.uri | http://hdl.handle.net/11449/184938 | |
| dc.identifier.wos | WOS:000446982300007 | |
| dc.language.iso | eng | |
| dc.publisher | Springer | |
| dc.relation.ispartof | Electrocatalysis | |
| dc.rights.accessRights | Acesso aberto | |
| dc.source | Web of Science | |
| dc.subject | Spongolite | |
| dc.subject | Zirconium(IV) | |
| dc.subject | Graphite paste electrode | |
| dc.subject | Hydrazine | |
| dc.title | Preparation and Voltammetric Application of a Zr(IV) Functionalized Spongolite for the Electrocatalytic Oxidation of Hydrazine | en |
| dc.type | Artigo | |
| dcterms.license | http://www.springer.com/open+access/authors+rights?SGWID=0-176704-12-683201-0 | |
| dcterms.rightsHolder | Springer | |
| dspace.entity.type | Publication | |
| unesp.author.orcid | 0000-0002-0949-6941[1] | |
| unesp.department | Física e Química - FEIS | pt |
